| Name | Ethyl hydrogen malonate |
| Synonyms | MONOETHYL MALONATE Monoethyl malonate mono-Ethyl malonate Malonic acid 1-ethyl Monoethyl malonic acid Ethyl hydrogen malonate ETHYL HYDROGEN MALONATE Ethoxycarbonylacetic acid 3-ethoxy-3-oxopropanoic acid 3-ethoxy-3-oxapropanoic acid Malonic acid monoethyl ester Malonic Acid Monomethyl Ester 3-ethoxy-3-oxo-propanoic acid Propanedioic acid monoethyl ester |
| CAS | 1071-46-1 |
| EINECS | 213-992-7 |
| InChI | InChI=1/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7) |
| InChIKey | HGINADPHJQTSKN-UHFFFAOYSA-N |
| Molecular Formula | C5H8O4 |
| Molar Mass | 132.11 |
| Density | 1.119 g/mL at 25 °C (lit.) |
| Melting Point | -13°C(lit.) |
| Boling Point | 106.5 °C/3 mmHg (lit.) |
| Flash Point | >230°F |
| Water Solubility | Miscible with water, chloroform and other solvents. |
| Solubility | Chloroform (Sparingly) |
| Vapor Presure | 0.0155mmHg at 25°C |
| Appearance | Liquid |
| Color | Pale yellow |
| BRN | 1758845 |
| pKa | pK1:3.55 (25°C) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.435(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29171900 |
| biological activity | monoethylmalonic acid (ethylhydromalonate, monoethylmalonate, 3-ethoxy-3-oxopropanic acid) is ethyl3-ethoxypropionate (EEP) the major urinary metabolites. |
| Use | pharmaceutical intermediates. |